C17H16N2O — CID 87671116
4-[(2-ethylpyrazolo[1,5-a]pyridin-3-yl)methyl]benzaldehyde (PubChem CID 87671116) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is 4-[(2-ethylpyrazolo[1,5-a]pyridin-3-yl)methyl]benzaldehyde.
| Compound Name | 4-[(2-ethylpyrazolo[1,5-a]pyridin-3-yl)methyl]benzaldehyde |
|---|---|
| PubChem CID | 87671116 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 4-[(2-ethylpyrazolo[1,5-a]pyridin-3-yl)methyl]benzaldehyde |
| SMILES | CCc1nn2ccccc2c1Cc1ccc(C=O)cc1 |
| InChI | InChI=1S/C17H16N2O/c1-2-16-15(17-5-3-4-10-19(17)18-16)11-13-6-8-14(12-20)9-7-13/h3-10,12H,2,11H2,1H3 |
| InChIKey | XEBMEGVQQBBIKE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|