C11H5F6NO3 — CID 87671246
5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1H-indole-2,3-dione (PubChem CID 87671246) has the molecular formula C11H5F6NO3 and a molecular weight of 313.15 g/mol. Its IUPAC name is 5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1H-indole-2,3-dione.
| Compound Name | 5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 87671246 |
| Molecular Formula | C11H5F6NO3 |
| Molecular Weight | 313.15 g/mol |
| Exact Mass | 313.02 |
| IUPAC Name | 5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-1H-indole-2,3-dione |
| SMILES | O=C1Nc2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2C1=O |
| InChI | InChI=1S/C11H5F6NO3/c12-10(13,14)9(21,11(15,16)17)4-1-2-6-5(3-4)7(19)8(20)18-6/h1-3,21H,(H,18,19,20) |
| InChIKey | DRKPQNFIJXAMRB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.15 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|