About (2,5-dioxopyrrolidin-1-yl) 4-methyl-3-(pyridin-2-yldisulfanyl)benzoate
(2,5-dioxopyrrolidin-1-yl) 4-methyl-3-(pyridin-2-yldisulfanyl)benzoate (PubChem CID 87671276) has the molecular formula C17H14N2O4S2
and a molecular weight of 374.44 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-methyl-3-(pyridin-2-yldisulfanyl)benzoate.
Molecular Properties
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-methyl-3-(pyridin-2-yldisulfanyl)benzoate |
| PubChem CID | 87671276 |
| Molecular Formula | C17H14N2O4S2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-methyl-3-(pyridin-2-yldisulfanyl)benzoate |
| SMILES | Cc1ccc(C(=O)ON2C(=O)CCC2=O)cc1SSc1ccccn1 |
| InChI | InChI=1S/C17H14N2O4S2/c1-11-5-6-12(17(22)23-19-15(20)7-8-16(19)21)10-13(11)24-25-14-4-2-3-9-18-14/h2-6,9-10H,7-8H2,1H3 |
| InChIKey | RDMIAOMXUCXRHJ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxopyrrolidin-1-yl) 4-methyl-3-(pyridin-2-yldisulfanyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxopyrrolidin-1-yl) 4-methyl-3-(pyridin-2-yldisulfanyl)benzoate?
The IUPAC name of (2,5-dioxopyrrolidin-1-yl) 4-methyl-3-(pyridin-2-yldisulfanyl)benzoate (CID 87671276) is (2,5-dioxopyrrolidin-1-yl) 4-methyl-3-(pyridin-2-yldisulfanyl)benzoate.
What is the SMILES notation for (2,5-dioxopyrrolidin-1-yl) 4-methyl-3-(pyridin-2-yldisulfanyl)benzoate?
The canonical SMILES for (2,5-dioxopyrrolidin-1-yl) 4-methyl-3-(pyridin-2-yldisulfanyl)benzoate is Cc1ccc(C(=O)ON2C(=O)CCC2=O)cc1SSc1ccccn1.
What is the InChIKey of (2,5-dioxopyrrolidin-1-yl) 4-methyl-3-(pyridin-2-yldisulfanyl)benzoate?
The InChIKey is RDMIAOMXUCXRHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O4S2/c1-11-5-6-12(17(22)23-19-15(20)7-8-16(19)21)10-13(11)24-25-14-4-2-3-9-18-14/h2-6,9-10H,7-8H2,1H3.
What are the key properties of (2,5-dioxopyrrolidin-1-yl) 4-methyl-3-(pyridin-2-yldisulfanyl)benzoate?
(2,5-dioxopyrrolidin-1-yl) 4-methyl-3-(pyridin-2-yldisulfanyl)benzoate has a molecular weight of 374.44 g/mol, XLogP of 3.41, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxopyrrolidin-1-yl) 4-methyl-3-(pyridin-2-yldisulfanyl)benzoate is sourced from PubChem (CID 87671276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).