About 1-methyl-2-[(3Z)-5-pentylundeca-1,3-dien-4-yl]hydrazine
1-methyl-2-[(3Z)-5-pentylundeca-1,3-dien-4-yl]hydrazine (PubChem CID 87671520) has the molecular formula C17H34N2
and a molecular weight of 266.47 g/mol. Its IUPAC name is 1-methyl-2-[(3Z)-5-pentylundeca-1,3-dien-4-yl]hydrazine.
Molecular Properties
| Compound Name | 1-methyl-2-[(3Z)-5-pentylundeca-1,3-dien-4-yl]hydrazine |
| PubChem CID | 87671520 |
| Molecular Formula | C17H34N2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.27 |
| IUPAC Name | 1-methyl-2-[(3Z)-5-pentylundeca-1,3-dien-4-yl]hydrazine |
| SMILES | C=C/C=C(\NNC)C(CCCCC)CCCCCC |
| InChI | InChI=1S/C17H34N2/c1-5-8-10-12-15-16(14-11-9-6-2)17(13-7-3)19-18-4/h7,13,16,18-19H,3,5-6,8-12,14-15H2,1-2,4H3/b17-13- |
| InChIKey | GKNAJPLISVTBKN-LGMDPLHJSA-N |
| XLogP | 4.95 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-[(3Z)-5-pentylundeca-1,3-dien-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-[(3Z)-5-pentylundeca-1,3-dien-4-yl]hydrazine?
The IUPAC name of 1-methyl-2-[(3Z)-5-pentylundeca-1,3-dien-4-yl]hydrazine (CID 87671520) is 1-methyl-2-[(3Z)-5-pentylundeca-1,3-dien-4-yl]hydrazine.
What is the SMILES notation for 1-methyl-2-[(3Z)-5-pentylundeca-1,3-dien-4-yl]hydrazine?
The canonical SMILES for 1-methyl-2-[(3Z)-5-pentylundeca-1,3-dien-4-yl]hydrazine is C=C/C=C(\NNC)C(CCCCC)CCCCCC.
What is the InChIKey of 1-methyl-2-[(3Z)-5-pentylundeca-1,3-dien-4-yl]hydrazine?
The InChIKey is GKNAJPLISVTBKN-LGMDPLHJSA-N. The full InChI is InChI=1S/C17H34N2/c1-5-8-10-12-15-16(14-11-9-6-2)17(13-7-3)19-18-4/h7,13,16,18-19H,3,5-6,8-12,14-15H2,1-2,4H3/b17-13-.
What are the key properties of 1-methyl-2-[(3Z)-5-pentylundeca-1,3-dien-4-yl]hydrazine?
1-methyl-2-[(3Z)-5-pentylundeca-1,3-dien-4-yl]hydrazine has a molecular weight of 266.47 g/mol, XLogP of 4.95, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-[(3Z)-5-pentylundeca-1,3-dien-4-yl]hydrazine is sourced from PubChem (CID 87671520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).