C24H20ClNO3S — CID 87672175
3-(4-chlorophenyl)-2-[(Z)-4-(2-cyanophenyl)-2-methylbut-2-enyl]benzenesulfonic acid (PubChem CID 87672175) has the molecular formula C24H20ClNO3S and a molecular weight of 437.95 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-[(Z)-4-(2-cyanophenyl)-2-methylbut-2-enyl]benzenesulfonic acid.
| Compound Name | 3-(4-chlorophenyl)-2-[(Z)-4-(2-cyanophenyl)-2-methylbut-2-enyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 87672175 |
| Molecular Formula | C24H20ClNO3S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.09 |
| IUPAC Name | 3-(4-chlorophenyl)-2-[(Z)-4-(2-cyanophenyl)-2-methylbut-2-enyl]benzenesulfonic acid |
| SMILES | C/C(=C/Cc1ccccc1C#N)Cc1c(-c2ccc(Cl)cc2)cccc1S(=O)(=O)O |
| InChI | InChI=1S/C24H20ClNO3S/c1-17(9-10-18-5-2-3-6-20(18)16-26)15-23-22(19-11-13-21(25)14-12-19)7-4-8-24(23)30(27,28)29/h2-9,11-14H,10,15H2,1H3,(H,27,28,29)/b17-9- |
| InChIKey | FLHCQBHPGYNIGT-MFOYZWKCSA-N |
| XLogP | 5.86 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|