About 2-sulfonylpyrrole;hydrochloride
2-sulfonylpyrrole;hydrochloride (PubChem CID 87672295) has the molecular formula C4H4ClNO2S
and a molecular weight of 165.60 g/mol. Its IUPAC name is 2-sulfonylpyrrole;hydrochloride.
Molecular Properties
| Compound Name | 2-sulfonylpyrrole;hydrochloride |
| PubChem CID | 87672295 |
| Molecular Formula | C4H4ClNO2S |
| Molecular Weight | 165.60 g/mol |
| Exact Mass | 164.97 |
| IUPAC Name | 2-sulfonylpyrrole;hydrochloride |
| SMILES | Cl.O=S(=O)=C1C=CC=N1 |
| InChI | InChI=1S/C4H3NO2S.ClH/c6-8(7)4-2-1-3-5-4;/h1-3H;1H |
| InChIKey | KHVRLCCFKPQABK-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.60 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfonylpyrrole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfonylpyrrole;hydrochloride?
The IUPAC name of 2-sulfonylpyrrole;hydrochloride (CID 87672295) is 2-sulfonylpyrrole;hydrochloride.
What is the SMILES notation for 2-sulfonylpyrrole;hydrochloride?
The canonical SMILES for 2-sulfonylpyrrole;hydrochloride is Cl.O=S(=O)=C1C=CC=N1.
What is the InChIKey of 2-sulfonylpyrrole;hydrochloride?
The InChIKey is KHVRLCCFKPQABK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3NO2S.ClH/c6-8(7)4-2-1-3-5-4;/h1-3H;1H.
What are the key properties of 2-sulfonylpyrrole;hydrochloride?
2-sulfonylpyrrole;hydrochloride has a molecular weight of 165.60 g/mol, XLogP of 0.06, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfonylpyrrole;hydrochloride is sourced from PubChem (CID 87672295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).