C17H17N3O3 — CID 87672451
(7R)-2-acetyl-1'-methylspiro[1,5,6,8-tetrahydrocyclopenta[g]quinoline-7,5'-imidazolidine]-2',4'-dione (PubChem CID 87672451) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is (7R)-2-acetyl-1'-methylspiro[1,5,6,8-tetrahydrocyclopenta[g]quinoline-7,5'-imidazolidine]-2',4'-dione.
| Compound Name | (7R)-2-acetyl-1'-methylspiro[1,5,6,8-tetrahydrocyclopenta[g]quinoline-7,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 87672451 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | (7R)-2-acetyl-1'-methylspiro[1,5,6,8-tetrahydrocyclopenta[g]quinoline-7,5'-imidazolidine]-2',4'-dione |
| SMILES | CC(=O)C1=CC=C2CC3=C(C=C2N1)C[C@]1(C3)C(=O)NC(=O)N1C |
| InChI | InChI=1S/C17H17N3O3/c1-9(21)13-4-3-10-5-11-7-17(8-12(11)6-14(10)18-13)15(22)19-16(23)20(17)2/h3-4,6,18H,5,7-8H2,1-2H3,(H,19,22,23)/t17-/m1/s1 |
| InChIKey | CVCYZULAOMIRJS-QGZVFWFLSA-N |
| XLogP | 1.29 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|