About 1-dipropoxyphosphoryl-2,3-diethylbenzene
1-dipropoxyphosphoryl-2,3-diethylbenzene (PubChem CID 87672620) has the molecular formula C16H27O3P
and a molecular weight of 298.36 g/mol. Its IUPAC name is 1-dipropoxyphosphoryl-2,3-diethylbenzene.
Molecular Properties
| Compound Name | 1-dipropoxyphosphoryl-2,3-diethylbenzene |
| PubChem CID | 87672620 |
| Molecular Formula | C16H27O3P |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 1-dipropoxyphosphoryl-2,3-diethylbenzene |
| SMILES | CCCOP(=O)(OCCC)c1cccc(CC)c1CC |
| InChI | InChI=1S/C16H27O3P/c1-5-12-18-20(17,19-13-6-2)16-11-9-10-14(7-3)15(16)8-4/h9-11H,5-8,12-13H2,1-4H3 |
| InChIKey | KQPMFXGLPKNFMA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-dipropoxyphosphoryl-2,3-diethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-dipropoxyphosphoryl-2,3-diethylbenzene?
The IUPAC name of 1-dipropoxyphosphoryl-2,3-diethylbenzene (CID 87672620) is 1-dipropoxyphosphoryl-2,3-diethylbenzene.
What is the SMILES notation for 1-dipropoxyphosphoryl-2,3-diethylbenzene?
The canonical SMILES for 1-dipropoxyphosphoryl-2,3-diethylbenzene is CCCOP(=O)(OCCC)c1cccc(CC)c1CC.
What is the InChIKey of 1-dipropoxyphosphoryl-2,3-diethylbenzene?
The InChIKey is KQPMFXGLPKNFMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27O3P/c1-5-12-18-20(17,19-13-6-2)16-11-9-10-14(7-3)15(16)8-4/h9-11H,5-8,12-13H2,1-4H3.
What are the key properties of 1-dipropoxyphosphoryl-2,3-diethylbenzene?
1-dipropoxyphosphoryl-2,3-diethylbenzene has a molecular weight of 298.36 g/mol, XLogP of 4.48, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-dipropoxyphosphoryl-2,3-diethylbenzene is sourced from PubChem (CID 87672620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).