C16H16O3 — CID 87672998
2-(2-hydroxy-3,4,5,6-tetramethylphenyl)-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol (PubChem CID 87672998) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-(2-hydroxy-3,4,5,6-tetramethylphenyl)-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol.
| Compound Name | 2-(2-hydroxy-3,4,5,6-tetramethylphenyl)-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol |
|---|---|
| PubChem CID | 87672998 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2-(2-hydroxy-3,4,5,6-tetramethylphenyl)-7-oxabicyclo[4.1.0]hepta-1(6),2,4-trien-3-ol |
| SMILES | Cc1c(C)c(C)c(-c2c(O)ccc3c2O3)c(O)c1C |
| InChI | InChI=1S/C16H16O3/c1-7-8(2)10(4)15(18)13(9(7)3)14-11(17)5-6-12-16(14)19-12/h5-6,17-18H,1-4H3 |
| InChIKey | OPBSVUYMJVGSCJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|