About (2-methyl-3-oxopropyl) octadecanoate
(2-methyl-3-oxopropyl) octadecanoate (PubChem CID 87673039) has the molecular formula C22H42O3
and a molecular weight of 354.58 g/mol. Its IUPAC name is (2-methyl-3-oxopropyl) octadecanoate.
Molecular Properties
| Compound Name | (2-methyl-3-oxopropyl) octadecanoate |
| PubChem CID | 87673039 |
| Molecular Formula | C22H42O3 |
| Molecular Weight | 354.58 g/mol |
| Exact Mass | 354.31 |
| IUPAC Name | (2-methyl-3-oxopropyl) octadecanoate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OCC(C)C=O |
| InChI | InChI=1S/C22H42O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(24)25-20-21(2)19-23/h19,21H,3-18,20H2,1-2H3 |
| InChIKey | ORNIOKBBIALXMW-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.58 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2-methyl-3-oxopropyl) octadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-3-oxopropyl) octadecanoate?
The IUPAC name of (2-methyl-3-oxopropyl) octadecanoate (CID 87673039) is (2-methyl-3-oxopropyl) octadecanoate.
What is the SMILES notation for (2-methyl-3-oxopropyl) octadecanoate?
The canonical SMILES for (2-methyl-3-oxopropyl) octadecanoate is CCCCCCCCCCCCCCCCCC(=O)OCC(C)C=O.
What is the InChIKey of (2-methyl-3-oxopropyl) octadecanoate?
The InChIKey is ORNIOKBBIALXMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(24)25-20-21(2)19-23/h19,21H,3-18,20H2,1-2H3.
What are the key properties of (2-methyl-3-oxopropyl) octadecanoate?
(2-methyl-3-oxopropyl) octadecanoate has a molecular weight of 354.58 g/mol, XLogP of 6.63, 19 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-3-oxopropyl) octadecanoate is sourced from PubChem (CID 87673039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).