C25H22F7NO4 — CID 87673264
(6R,7S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(4-fluorophenyl)-2-methyl-3-oxo-5,6,7,8-tetrahydro-1H-pyrrolizine-2-carboxylic acid (PubChem CID 87673264) has the molecular formula C25H22F7NO4 and a molecular weight of 533.44 g/mol. Its IUPAC name is (6R,7S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(4-fluorophenyl)-2-methyl-3-oxo-5,6,7,8-tetrahydro-1H-pyrrolizine-2-carboxylic acid.
| Compound Name | (6R,7S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(4-fluorophenyl)-2-methyl-3-oxo-5,6,7,8-tetrahydro-1H-pyrrolizine-2-carboxylic acid |
|---|---|
| PubChem CID | 87673264 |
| Molecular Formula | C25H22F7NO4 |
| Molecular Weight | 533.44 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | (6R,7S)-6-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-7-(4-fluorophenyl)-2-methyl-3-oxo-5,6,7,8-tetrahydro-1H-pyrrolizine-2-carboxylic acid |
| SMILES | C[C@@H](O[C@H]1CN2C(=O)C(C)(C(=O)O)CC2[C@@H]1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H22F7NO4/c1-12(14-7-15(24(27,28)29)9-16(8-14)25(30,31)32)37-19-11-33-18(10-23(2,21(33)34)22(35)36)20(19)13-3-5-17(26)6-4-13/h3-9,12,18-20H,10-11H2,1-2H3,(H,35,36)/t12-,18?,19+,20+,23?/m1/s1 |
| InChIKey | KLSWTVAHKWGNJZ-UIMYUKROSA-N |
| XLogP | 5.80 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.44 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|