About 1-azabicyclo[3.3.1]nonan-4-yl 2-thiophen-2-yl-1,3-thiazole-4-carboxylate
1-azabicyclo[3.3.1]nonan-4-yl 2-thiophen-2-yl-1,3-thiazole-4-carboxylate (PubChem CID 87673344) has the molecular formula C16H18N2O2S2
and a molecular weight of 334.47 g/mol. Its IUPAC name is 1-azabicyclo[3.3.1]nonan-4-yl 2-thiophen-2-yl-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | 1-azabicyclo[3.3.1]nonan-4-yl 2-thiophen-2-yl-1,3-thiazole-4-carboxylate |
| PubChem CID | 87673344 |
| Molecular Formula | C16H18N2O2S2 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 1-azabicyclo[3.3.1]nonan-4-yl 2-thiophen-2-yl-1,3-thiazole-4-carboxylate |
| SMILES | O=C(OC1CCN2CCCC1C2)c1csc(-c2cccs2)n1 |
| InChI | InChI=1S/C16H18N2O2S2/c19-16(12-10-22-15(17-12)14-4-2-8-21-14)20-13-5-7-18-6-1-3-11(13)9-18/h2,4,8,10-11,13H,1,3,5-7,9H2 |
| InChIKey | WZPIIZIHXQKMMC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-azabicyclo[3.3.1]nonan-4-yl 2-thiophen-2-yl-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-azabicyclo[3.3.1]nonan-4-yl 2-thiophen-2-yl-1,3-thiazole-4-carboxylate?
The IUPAC name of 1-azabicyclo[3.3.1]nonan-4-yl 2-thiophen-2-yl-1,3-thiazole-4-carboxylate (CID 87673344) is 1-azabicyclo[3.3.1]nonan-4-yl 2-thiophen-2-yl-1,3-thiazole-4-carboxylate.
What is the SMILES notation for 1-azabicyclo[3.3.1]nonan-4-yl 2-thiophen-2-yl-1,3-thiazole-4-carboxylate?
The canonical SMILES for 1-azabicyclo[3.3.1]nonan-4-yl 2-thiophen-2-yl-1,3-thiazole-4-carboxylate is O=C(OC1CCN2CCCC1C2)c1csc(-c2cccs2)n1.
What is the InChIKey of 1-azabicyclo[3.3.1]nonan-4-yl 2-thiophen-2-yl-1,3-thiazole-4-carboxylate?
The InChIKey is WZPIIZIHXQKMMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O2S2/c19-16(12-10-22-15(17-12)14-4-2-8-21-14)20-13-5-7-18-6-1-3-11(13)9-18/h2,4,8,10-11,13H,1,3,5-7,9H2.
What are the key properties of 1-azabicyclo[3.3.1]nonan-4-yl 2-thiophen-2-yl-1,3-thiazole-4-carboxylate?
1-azabicyclo[3.3.1]nonan-4-yl 2-thiophen-2-yl-1,3-thiazole-4-carboxylate has a molecular weight of 334.47 g/mol, XLogP of 3.51, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-azabicyclo[3.3.1]nonan-4-yl 2-thiophen-2-yl-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 87673344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).