About 2-methylprop-2-enoxy 2-hydroxypropane-1-sulfonate
2-methylprop-2-enoxy 2-hydroxypropane-1-sulfonate (PubChem CID 87673391) has the molecular formula C7H14O5S
and a molecular weight of 210.25 g/mol. Its IUPAC name is 2-methylprop-2-enoxy 2-hydroxypropane-1-sulfonate.
Molecular Properties
| Compound Name | 2-methylprop-2-enoxy 2-hydroxypropane-1-sulfonate |
| PubChem CID | 87673391 |
| Molecular Formula | C7H14O5S |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 2-methylprop-2-enoxy 2-hydroxypropane-1-sulfonate |
| SMILES | C=C(C)COOS(=O)(=O)CC(C)O |
| InChI | InChI=1S/C7H14O5S/c1-6(2)4-11-12-13(9,10)5-7(3)8/h7-8H,1,4-5H2,2-3H3 |
| InChIKey | UMTDGZSTZLBLMN-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enoxy 2-hydroxypropane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enoxy 2-hydroxypropane-1-sulfonate?
The IUPAC name of 2-methylprop-2-enoxy 2-hydroxypropane-1-sulfonate (CID 87673391) is 2-methylprop-2-enoxy 2-hydroxypropane-1-sulfonate.
What is the SMILES notation for 2-methylprop-2-enoxy 2-hydroxypropane-1-sulfonate?
The canonical SMILES for 2-methylprop-2-enoxy 2-hydroxypropane-1-sulfonate is C=C(C)COOS(=O)(=O)CC(C)O.
What is the InChIKey of 2-methylprop-2-enoxy 2-hydroxypropane-1-sulfonate?
The InChIKey is UMTDGZSTZLBLMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O5S/c1-6(2)4-11-12-13(9,10)5-7(3)8/h7-8H,1,4-5H2,2-3H3.
What are the key properties of 2-methylprop-2-enoxy 2-hydroxypropane-1-sulfonate?
2-methylprop-2-enoxy 2-hydroxypropane-1-sulfonate has a molecular weight of 210.25 g/mol, XLogP of 0.22, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enoxy 2-hydroxypropane-1-sulfonate is sourced from PubChem (CID 87673391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).