C9H26N4 — CID 87673451
N'-ethylethane-1,2-diamine;1-N'-ethylpropane-1,1-diamine (PubChem CID 87673451) has the molecular formula C9H26N4 and a molecular weight of 190.33 g/mol. Its IUPAC name is N'-ethylethane-1,2-diamine;1-N'-ethylpropane-1,1-diamine.
| Compound Name | N'-ethylethane-1,2-diamine;1-N'-ethylpropane-1,1-diamine |
|---|---|
| PubChem CID | 87673451 |
| Molecular Formula | C9H26N4 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.22 |
| IUPAC Name | N'-ethylethane-1,2-diamine;1-N'-ethylpropane-1,1-diamine |
| SMILES | CCNC(N)CC.CCNCCN |
| InChI | InChI=1S/C5H14N2.C4H12N2/c1-3-5(6)7-4-2;1-2-6-4-3-5/h5,7H,3-4,6H2,1-2H3;6H,2-5H2,1H3 |
| InChIKey | VSSGCFLQQREERB-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|