About (E)-hex-2-en-1-ol;2-methyloctan-2-ol
(E)-hex-2-en-1-ol;2-methyloctan-2-ol (PubChem CID 87673623) has the molecular formula C15H32O2
and a molecular weight of 244.42 g/mol. Its IUPAC name is (E)-hex-2-en-1-ol;2-methyloctan-2-ol.
Molecular Properties
| Compound Name | (E)-hex-2-en-1-ol;2-methyloctan-2-ol |
| PubChem CID | 87673623 |
| Molecular Formula | C15H32O2 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.24 |
| IUPAC Name | (E)-hex-2-en-1-ol;2-methyloctan-2-ol |
| SMILES | CCC/C=C/CO.CCCCCCC(C)(C)O |
| InChI | InChI=1S/C9H20O.C6H12O/c1-4-5-6-7-8-9(2,3)10;1-2-3-4-5-6-7/h10H,4-8H2,1-3H3;4-5,7H,2-3,6H2,1H3/b;5-4+ |
| InChIKey | OAUZPMFYQVZVNJ-RCKHEGBHSA-N |
| XLogP | 4.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-hex-2-en-1-ol;2-methyloctan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-hex-2-en-1-ol;2-methyloctan-2-ol?
The IUPAC name of (E)-hex-2-en-1-ol;2-methyloctan-2-ol (CID 87673623) is (E)-hex-2-en-1-ol;2-methyloctan-2-ol.
What is the SMILES notation for (E)-hex-2-en-1-ol;2-methyloctan-2-ol?
The canonical SMILES for (E)-hex-2-en-1-ol;2-methyloctan-2-ol is CCC/C=C/CO.CCCCCCC(C)(C)O.
What is the InChIKey of (E)-hex-2-en-1-ol;2-methyloctan-2-ol?
The InChIKey is OAUZPMFYQVZVNJ-RCKHEGBHSA-N. The full InChI is InChI=1S/C9H20O.C6H12O/c1-4-5-6-7-8-9(2,3)10;1-2-3-4-5-6-7/h10H,4-8H2,1-3H3;4-5,7H,2-3,6H2,1H3/b;5-4+.
What are the key properties of (E)-hex-2-en-1-ol;2-methyloctan-2-ol?
(E)-hex-2-en-1-ol;2-methyloctan-2-ol has a molecular weight of 244.42 g/mol, XLogP of 4.06, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-hex-2-en-1-ol;2-methyloctan-2-ol is sourced from PubChem (CID 87673623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).