About dichlorozirconium(2+);1-ethyl-1H-indene;1-propyl-1H-indene
dichlorozirconium(2+);1-ethyl-1H-indene;1-propyl-1H-indene (PubChem CID 87674465) has the molecular formula C23H24Cl2Zr
and a molecular weight of 462.58 g/mol. Its IUPAC name is dichlorozirconium(2+);1-ethyl-1H-indene;1-propyl-1H-indene.
Molecular Properties
| Compound Name | dichlorozirconium(2+);1-ethyl-1H-indene;1-propyl-1H-indene |
| PubChem CID | 87674465 |
| Molecular Formula | C23H24Cl2Zr |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 460.03 |
| IUPAC Name | dichlorozirconium(2+);1-ethyl-1H-indene;1-propyl-1H-indene |
| SMILES | Cl[Zr+2]Cl.[CH2-]CC1C=Cc2ccccc21.[CH2-]CCC1C=Cc2ccccc21 |
| InChI | InChI=1S/C12H13.C11H11.2ClH.Zr/c1-2-5-10-8-9-11-6-3-4-7-12(10)11;1-2-9-7-8-10-5-3-4-6-11(9)10;;;/h3-4,6-10H,1-2,5H2;3-9H,1-2H2;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | JKJOFFWWKDIOHP-UHFFFAOYSA-L |
| XLogP | 7.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dichlorozirconium(2+);1-ethyl-1H-indene;1-propyl-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozirconium(2+);1-ethyl-1H-indene;1-propyl-1H-indene?
The IUPAC name of dichlorozirconium(2+);1-ethyl-1H-indene;1-propyl-1H-indene (CID 87674465) is dichlorozirconium(2+);1-ethyl-1H-indene;1-propyl-1H-indene.
What is the SMILES notation for dichlorozirconium(2+);1-ethyl-1H-indene;1-propyl-1H-indene?
The canonical SMILES for dichlorozirconium(2+);1-ethyl-1H-indene;1-propyl-1H-indene is Cl[Zr+2]Cl.[CH2-]CC1C=Cc2ccccc21.[CH2-]CCC1C=Cc2ccccc21.
What is the InChIKey of dichlorozirconium(2+);1-ethyl-1H-indene;1-propyl-1H-indene?
The InChIKey is JKJOFFWWKDIOHP-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H13.C11H11.2ClH.Zr/c1-2-5-10-8-9-11-6-3-4-7-12(10)11;1-2-9-7-8-10-5-3-4-6-11(9)10;;;/h3-4,6-10H,1-2,5H2;3-9H,1-2H2;2*1H;/q2*-1;;;+4/p-2.
What are the key properties of dichlorozirconium(2+);1-ethyl-1H-indene;1-propyl-1H-indene?
dichlorozirconium(2+);1-ethyl-1H-indene;1-propyl-1H-indene has a molecular weight of 462.58 g/mol, XLogP of 7.81, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozirconium(2+);1-ethyl-1H-indene;1-propyl-1H-indene is sourced from PubChem (CID 87674465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).