C25H32F6N10O5S — CID 87674494
3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-5-[(3R)-3-methylpiperazin-1-yl]-N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine;2,2,2-trifluoroacetic acid (PubChem CID 87674494) has the molecular formula C25H32F6N10O5S and a molecular weight of 698.65 g/mol. Its IUPAC name is 3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-5-[(3R)-3-methylpiperazin-1-yl]-N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-5-[(3R)-3-methylpiperazin-1-yl]-N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87674494 |
| Molecular Formula | C25H32F6N10O5S |
| Molecular Weight | 698.65 g/mol |
| Exact Mass | 698.22 |
| IUPAC Name | 3-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-5-[(3R)-3-methylpiperazin-1-yl]-N-pyrimidin-4-yl-1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrazolo[4,5-d]pyrimidin-7-amine;2,2,2-trifluoroacetic acid |
| SMILES | C[C@@H]1CN(c2nc(Nc3ccncn3)c3c(n2)c(CN2CCS(=O)(=O)CC2)nn3CCOCC(F)(F)F)CCN1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H31F3N10O3S.C2HF3O2/c1-16-12-35(5-4-28-16)22-31-19-17(13-34-7-10-40(37,38)11-8-34)33-36(6-9-39-14-23(24,25)26)20(19)21(32-22)30-18-2-3-27-15-29-18;3-2(4,5)1(6)7/h2-3,15-16,28H,4-14H2,1H3,(H,27,29,30,31,32);(H,6,7)/t16-;/m1./s1 |
| InChIKey | NBARAHURYSEYCG-PKLMIRHRSA-N |
| XLogP | 1.60 |
| TPSA | 180.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.65 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|