C25H25ClN4S — CID 87674519
N,N-dibenzyl-4-[(3,5-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline chloride (PubChem CID 87674519) has the molecular formula C25H25ClN4S and a molecular weight of 449.02 g/mol. Its IUPAC name is N,N-dibenzyl-4-[(3,5-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline chloride.
| Compound Name | N,N-dibenzyl-4-[(3,5-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline chloride |
|---|---|
| PubChem CID | 87674519 |
| Molecular Formula | C25H25ClN4S |
| Molecular Weight | 449.02 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | N,N-dibenzyl-4-[(3,5-dimethyl-1,3-thiazol-3-ium-2-yl)diazenyl]aniline chloride |
| SMILES | Cc1c[n+](C)c(/N=N/c2ccc(N(Cc3ccccc3)Cc3ccccc3)cc2)s1.[Cl-] |
| InChI | InChI=1S/C25H25N4S.ClH/c1-20-17-28(2)25(30-20)27-26-23-13-15-24(16-14-23)29(18-21-9-5-3-6-10-21)19-22-11-7-4-8-12-22;/h3-17H,18-19H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | SJTLQQYLAPZCRU-UHFFFAOYSA-M |
| XLogP | 3.51 |
| TPSA | 31.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.02 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|