About 1H-indazole-3-carboxylic acid;N-methoxymethanamine
1H-indazole-3-carboxylic acid;N-methoxymethanamine (PubChem CID 87675223) has the molecular formula C10H13N3O3
and a molecular weight of 223.23 g/mol. Its IUPAC name is 1H-indazole-3-carboxylic acid;N-methoxymethanamine.
Molecular Properties
| Compound Name | 1H-indazole-3-carboxylic acid;N-methoxymethanamine |
| PubChem CID | 87675223 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 1H-indazole-3-carboxylic acid;N-methoxymethanamine |
| SMILES | CNOC.O=C(O)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C8H6N2O2.C2H7NO/c11-8(12)7-5-3-1-2-4-6(5)9-10-7;1-3-4-2/h1-4H,(H,9,10)(H,11,12);3H,1-2H3 |
| InChIKey | AFFVXBOQCOZYIV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1H-indazole-3-carboxylic acid;N-methoxymethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indazole-3-carboxylic acid;N-methoxymethanamine?
The IUPAC name of 1H-indazole-3-carboxylic acid;N-methoxymethanamine (CID 87675223) is 1H-indazole-3-carboxylic acid;N-methoxymethanamine.
What is the SMILES notation for 1H-indazole-3-carboxylic acid;N-methoxymethanamine?
The canonical SMILES for 1H-indazole-3-carboxylic acid;N-methoxymethanamine is CNOC.O=C(O)c1n[nH]c2ccccc12.
What is the InChIKey of 1H-indazole-3-carboxylic acid;N-methoxymethanamine?
The InChIKey is AFFVXBOQCOZYIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O2.C2H7NO/c11-8(12)7-5-3-1-2-4-6(5)9-10-7;1-3-4-2/h1-4H,(H,9,10)(H,11,12);3H,1-2H3.
What are the key properties of 1H-indazole-3-carboxylic acid;N-methoxymethanamine?
1H-indazole-3-carboxylic acid;N-methoxymethanamine has a molecular weight of 223.23 g/mol, XLogP of 1.03, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indazole-3-carboxylic acid;N-methoxymethanamine is sourced from PubChem (CID 87675223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).