C16H17N5O6 — CID 87675756
(3S)-4-[[(1S)-1-carboxy-2-phenylethyl]-prop-2-ynoxyamino]-3-(2-diazohydrazinyl)-4-oxobutanoic acid (PubChem CID 87675756) has the molecular formula C16H17N5O6 and a molecular weight of 375.34 g/mol. Its IUPAC name is (3S)-4-[[(1S)-1-carboxy-2-phenylethyl]-prop-2-ynoxyamino]-3-(2-diazohydrazinyl)-4-oxobutanoic acid.
| Compound Name | (3S)-4-[[(1S)-1-carboxy-2-phenylethyl]-prop-2-ynoxyamino]-3-(2-diazohydrazinyl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 87675756 |
| Molecular Formula | C16H17N5O6 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | (3S)-4-[[(1S)-1-carboxy-2-phenylethyl]-prop-2-ynoxyamino]-3-(2-diazohydrazinyl)-4-oxobutanoic acid |
| SMILES | C#CCON(C(=O)[C@H](CC(=O)O)NN=[N+]=[N-])[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C16H17N5O6/c1-2-8-27-21(15(24)12(10-14(22)23)18-20-19-17)13(16(25)26)9-11-6-4-3-5-7-11/h1,3-7,12-13,18H,8-10H2,(H,22,23)(H,25,26)/t12-,13-/m0/s1 |
| InChIKey | USRWHFQQEWOKGP-STQMWFEESA-N |
| XLogP | 0.73 |
| TPSA | 164.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|