C27H33ClN4O7S — CID 87675836
[(6-chloronaphthalen-2-yl)sulfonyl-[(3S)-2-oxo-1-[(2S)-1-oxo-1-[2-(pyrrolidin-1-ylmethyl)morpholin-4-yl]propan-2-yl]pyrrolidin-3-yl]amino] formate (PubChem CID 87675836) has the molecular formula C27H33ClN4O7S and a molecular weight of 593.10 g/mol. Its IUPAC name is [(6-chloronaphthalen-2-yl)sulfonyl-[(3S)-2-oxo-1-[(2S)-1-oxo-1-[2-(pyrrolidin-1-ylmethyl)morpholin-4-yl]propan-2-yl]pyrrolidin-3-yl]amino] formate.
| Compound Name | [(6-chloronaphthalen-2-yl)sulfonyl-[(3S)-2-oxo-1-[(2S)-1-oxo-1-[2-(pyrrolidin-1-ylmethyl)morpholin-4-yl]propan-2-yl]pyrrolidin-3-yl]amino] formate |
|---|---|
| PubChem CID | 87675836 |
| Molecular Formula | C27H33ClN4O7S |
| Molecular Weight | 593.10 g/mol |
| Exact Mass | 592.18 |
| IUPAC Name | [(6-chloronaphthalen-2-yl)sulfonyl-[(3S)-2-oxo-1-[(2S)-1-oxo-1-[2-(pyrrolidin-1-ylmethyl)morpholin-4-yl]propan-2-yl]pyrrolidin-3-yl]amino] formate |
| SMILES | C[C@@H](C(=O)N1CCOC(CN2CCCC2)C1)N1CC[C@H](N(OC=O)S(=O)(=O)c2ccc3cc(Cl)ccc3c2)C1=O |
| InChI | InChI=1S/C27H33ClN4O7S/c1-19(26(34)30-12-13-38-23(17-30)16-29-9-2-3-10-29)31-11-8-25(27(31)35)32(39-18-33)40(36,37)24-7-5-20-14-22(28)6-4-21(20)15-24/h4-7,14-15,18-19,23,25H,2-3,8-13,16-17H2,1H3/t19-,23?,25-/m0/s1 |
| InChIKey | VVELUUZZYFREOD-ZSTBOYNDSA-N |
| XLogP | 1.88 |
| TPSA | 116.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.10 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|