C16H23NO3 — CID 87675926
4-(ethoxyamino)-7,8-dimethylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-6-ol (PubChem CID 87675926) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 4-(ethoxyamino)-7,8-dimethylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-6-ol.
| Compound Name | 4-(ethoxyamino)-7,8-dimethylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-6-ol |
|---|---|
| PubChem CID | 87675926 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 4-(ethoxyamino)-7,8-dimethylspiro[3,4-dihydrochromene-2,1'-cyclobutane]-6-ol |
| SMILES | CCONC1CC2(CCC2)Oc2c1cc(O)c(C)c2C |
| InChI | InChI=1S/C16H23NO3/c1-4-19-17-13-9-16(6-5-7-16)20-15-11(3)10(2)14(18)8-12(13)15/h8,13,17-18H,4-7,9H2,1-3H3 |
| InChIKey | PEIKIKYYXVNQEU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|