C28H28ClF3N4O4 — CID 87675980
5-[(6-chloro-3-pyridinyl)methoxy]-N-[4-(diethylaminomethyl)phenyl]-1H-indole-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 87675980) has the molecular formula C28H28ClF3N4O4 and a molecular weight of 577.00 g/mol. Its IUPAC name is 5-[(6-chloro-3-pyridinyl)methoxy]-N-[4-(diethylaminomethyl)phenyl]-1H-indole-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 5-[(6-chloro-3-pyridinyl)methoxy]-N-[4-(diethylaminomethyl)phenyl]-1H-indole-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87675980 |
| Molecular Formula | C28H28ClF3N4O4 |
| Molecular Weight | 577.00 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | 5-[(6-chloro-3-pyridinyl)methoxy]-N-[4-(diethylaminomethyl)phenyl]-1H-indole-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCN(CC)Cc1ccc(NC(=O)c2cc3cc(OCc4ccc(Cl)nc4)ccc3[nH]2)cc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H27ClN4O2.C2HF3O2/c1-3-31(4-2)16-18-5-8-21(9-6-18)29-26(32)24-14-20-13-22(10-11-23(20)30-24)33-17-19-7-12-25(27)28-15-19;3-2(4,5)1(6)7/h5-15,30H,3-4,16-17H2,1-2H3,(H,29,32);(H,6,7) |
| InChIKey | HZUAJTZSGJRQMQ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 107.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.00 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|