About 2-[5-methyl-2-[(E)-pent-2-en-2-yl]-1,3-oxazol-4-yl]ethyl methanesulfonate
2-[5-methyl-2-[(E)-pent-2-en-2-yl]-1,3-oxazol-4-yl]ethyl methanesulfonate (PubChem CID 87676557) has the molecular formula C12H19NO4S
and a molecular weight of 273.35 g/mol. Its IUPAC name is 2-[5-methyl-2-[(E)-pent-2-en-2-yl]-1,3-oxazol-4-yl]ethyl methanesulfonate.
Molecular Properties
| Compound Name | 2-[5-methyl-2-[(E)-pent-2-en-2-yl]-1,3-oxazol-4-yl]ethyl methanesulfonate |
| PubChem CID | 87676557 |
| Molecular Formula | C12H19NO4S |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2-[5-methyl-2-[(E)-pent-2-en-2-yl]-1,3-oxazol-4-yl]ethyl methanesulfonate |
| SMILES | CC/C=C(\C)c1nc(CCOS(C)(=O)=O)c(C)o1 |
| InChI | InChI=1S/C12H19NO4S/c1-5-6-9(2)12-13-11(10(3)17-12)7-8-16-18(4,14)15/h6H,5,7-8H2,1-4H3/b9-6+ |
| InChIKey | XFOHPGHKIDAKCC-RMKNXTFCSA-N |
| XLogP | 2.32 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-methyl-2-[(E)-pent-2-en-2-yl]-1,3-oxazol-4-yl]ethyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-methyl-2-[(E)-pent-2-en-2-yl]-1,3-oxazol-4-yl]ethyl methanesulfonate?
The IUPAC name of 2-[5-methyl-2-[(E)-pent-2-en-2-yl]-1,3-oxazol-4-yl]ethyl methanesulfonate (CID 87676557) is 2-[5-methyl-2-[(E)-pent-2-en-2-yl]-1,3-oxazol-4-yl]ethyl methanesulfonate.
What is the SMILES notation for 2-[5-methyl-2-[(E)-pent-2-en-2-yl]-1,3-oxazol-4-yl]ethyl methanesulfonate?
The canonical SMILES for 2-[5-methyl-2-[(E)-pent-2-en-2-yl]-1,3-oxazol-4-yl]ethyl methanesulfonate is CC/C=C(\C)c1nc(CCOS(C)(=O)=O)c(C)o1.
What is the InChIKey of 2-[5-methyl-2-[(E)-pent-2-en-2-yl]-1,3-oxazol-4-yl]ethyl methanesulfonate?
The InChIKey is XFOHPGHKIDAKCC-RMKNXTFCSA-N. The full InChI is InChI=1S/C12H19NO4S/c1-5-6-9(2)12-13-11(10(3)17-12)7-8-16-18(4,14)15/h6H,5,7-8H2,1-4H3/b9-6+.
What are the key properties of 2-[5-methyl-2-[(E)-pent-2-en-2-yl]-1,3-oxazol-4-yl]ethyl methanesulfonate?
2-[5-methyl-2-[(E)-pent-2-en-2-yl]-1,3-oxazol-4-yl]ethyl methanesulfonate has a molecular weight of 273.35 g/mol, XLogP of 2.32, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-methyl-2-[(E)-pent-2-en-2-yl]-1,3-oxazol-4-yl]ethyl methanesulfonate is sourced from PubChem (CID 87676557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).