C20H24ClF5N7+ — CID 87676778
3-[4-[5-chloro-7-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-3,5-difluoroanilino]propyl-trimethylazanium (PubChem CID 87676778) has the molecular formula C20H24ClF5N7+ and a molecular weight of 492.90 g/mol. Its IUPAC name is 3-[4-[5-chloro-7-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-3,5-difluoroanilino]propyl-trimethylazanium.
| Compound Name | 3-[4-[5-chloro-7-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-3,5-difluoroanilino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 87676778 |
| Molecular Formula | C20H24ClF5N7+ |
| Molecular Weight | 492.90 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | 3-[4-[5-chloro-7-[[(2S)-1,1,1-trifluoropropan-2-yl]amino]-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl]-3,5-difluoroanilino]propyl-trimethylazanium |
| SMILES | C[C@H](Nc1c(-c2c(F)cc(NCCC[N+](C)(C)C)cc2F)c(Cl)nc2ncnn12)C(F)(F)F |
| InChI | InChI=1S/C20H24ClF5N7/c1-11(20(24,25)26)30-18-16(17(21)31-19-28-10-29-32(18)19)15-13(22)8-12(9-14(15)23)27-6-5-7-33(2,3)4/h8-11,27,30H,5-7H2,1-4H3/q+1/t11-/m0/s1 |
| InChIKey | CMWTZZVQPATBTP-NSHDSACASA-N |
| XLogP | 4.59 |
| TPSA | 67.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.90 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|