C25H26N5O3S+ — CID 87676816
(2S)-1-[2-(1-methylbenzimidazol-2-yl)sulfanylacetyl]-1-[(3-phenyl-1,2-oxazol-5-yl)methyl]pyrrolidin-1-ium-2-carboxamide (PubChem CID 87676816) has the molecular formula C25H26N5O3S+ and a molecular weight of 476.58 g/mol. Its IUPAC name is (2S)-1-[2-(1-methylbenzimidazol-2-yl)sulfanylacetyl]-1-[(3-phenyl-1,2-oxazol-5-yl)methyl]pyrrolidin-1-ium-2-carboxamide.
| Compound Name | (2S)-1-[2-(1-methylbenzimidazol-2-yl)sulfanylacetyl]-1-[(3-phenyl-1,2-oxazol-5-yl)methyl]pyrrolidin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 87676816 |
| Molecular Formula | C25H26N5O3S+ |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | (2S)-1-[2-(1-methylbenzimidazol-2-yl)sulfanylacetyl]-1-[(3-phenyl-1,2-oxazol-5-yl)methyl]pyrrolidin-1-ium-2-carboxamide |
| SMILES | Cn1c(SCC(=O)[N+]2(Cc3cc(-c4ccccc4)no3)CCC[C@H]2C(N)=O)nc2ccccc21 |
| InChI | InChI=1S/C25H25N5O3S/c1-29-21-11-6-5-10-19(21)27-25(29)34-16-23(31)30(13-7-12-22(30)24(26)32)15-18-14-20(28-33-18)17-8-3-2-4-9-17/h2-6,8-11,14,22H,7,12-13,15-16H2,1H3,(H-,26,32)/p+1/t22-,30?/m0/s1 |
| InChIKey | WLUYNCYBCWSVNS-VUUJKMBOSA-O |
| XLogP | 3.51 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|