About 2-methyl-8H-indeno[2,1-b]thiophene
2-methyl-8H-indeno[2,1-b]thiophene (PubChem CID 87676888) has the molecular formula C12H10S
and a molecular weight of 186.28 g/mol. Its IUPAC name is 2-methyl-8H-indeno[2,1-b]thiophene.
Molecular Properties
| Compound Name | 2-methyl-8H-indeno[2,1-b]thiophene |
| PubChem CID | 87676888 |
| Molecular Formula | C12H10S |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 2-methyl-8H-indeno[2,1-b]thiophene |
| SMILES | Cc1cc2c(s1)=CC1=CC=CCC=21 |
| InChI | InChI=1S/C12H10S/c1-8-6-11-10-5-3-2-4-9(10)7-12(11)13-8/h2-4,6-7H,5H2,1H3 |
| InChIKey | OTGDHOCKEODTKM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-8H-indeno[2,1-b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-8H-indeno[2,1-b]thiophene?
The IUPAC name of 2-methyl-8H-indeno[2,1-b]thiophene (CID 87676888) is 2-methyl-8H-indeno[2,1-b]thiophene.
What is the SMILES notation for 2-methyl-8H-indeno[2,1-b]thiophene?
The canonical SMILES for 2-methyl-8H-indeno[2,1-b]thiophene is Cc1cc2c(s1)=CC1=CC=CCC=21.
What is the InChIKey of 2-methyl-8H-indeno[2,1-b]thiophene?
The InChIKey is OTGDHOCKEODTKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10S/c1-8-6-11-10-5-3-2-4-9(10)7-12(11)13-8/h2-4,6-7H,5H2,1H3.
What are the key properties of 2-methyl-8H-indeno[2,1-b]thiophene?
2-methyl-8H-indeno[2,1-b]thiophene has a molecular weight of 186.28 g/mol, XLogP of 1.89, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-8H-indeno[2,1-b]thiophene is sourced from PubChem (CID 87676888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).