C22H37NO7Si — CID 87677596
[(4R)-4-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-1,3-dioxopent-1-en-2-yl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 87677596) has the molecular formula C22H37NO7Si and a molecular weight of 455.62 g/mol. Its IUPAC name is [(4R)-4-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-1,3-dioxopent-1-en-2-yl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [(4R)-4-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-1,3-dioxopent-1-en-2-yl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 87677596 |
| Molecular Formula | C22H37NO7Si |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.23 |
| IUPAC Name | [(4R)-4-[(2S,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl]-1,3-dioxopent-1-en-2-yl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1C(=O)N[C@H]1[C@@H](C)C(=O)C(=C=O)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C22H37NO7Si/c1-13(18(25)15(11-24)28-12-29-20(27)21(3,4)5)17-16(19(26)23-17)14(2)30-31(9,10)22(6,7)8/h13-14,16-17H,12H2,1-10H3,(H,23,26)/t13-,14-,16-,17+/m1/s1 |
| InChIKey | TVJVSXZQTGLUIU-SRABZTEZSA-N |
| XLogP | 3.00 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|