C25H30F3N3O5S — CID 87677783
N-[2-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoethyl]formamide;4-methylbenzenesulfonic acid (PubChem CID 87677783) has the molecular formula C25H30F3N3O5S and a molecular weight of 541.59 g/mol. Its IUPAC name is N-[2-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoethyl]formamide;4-methylbenzenesulfonic acid.
| Compound Name | N-[2-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoethyl]formamide;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87677783 |
| Molecular Formula | C25H30F3N3O5S |
| Molecular Weight | 541.59 g/mol |
| Exact Mass | 541.19 |
| IUPAC Name | N-[2-[3-[(1R)-1-amino-2-(2,4,5-trifluorophenyl)ethyl]-8-azabicyclo[3.2.1]octan-8-yl]-2-oxoethyl]formamide;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.N[C@H](Cc1cc(F)c(F)cc1F)C1CC2CCC(C1)N2C(=O)CNC=O |
| InChI | InChI=1S/C18H22F3N3O2.C7H8O3S/c19-14-7-16(21)15(20)5-10(14)6-17(22)11-3-12-1-2-13(4-11)24(12)18(26)8-23-9-25;1-6-2-4-7(5-3-6)11(8,9)10/h5,7,9,11-13,17H,1-4,6,8,22H2,(H,23,25);2-5H,1H3,(H,8,9,10)/t11?,12?,13?,17-;/m1./s1 |
| InChIKey | MGPHJCGASDKKKR-RVPXEYRWSA-N |
| XLogP | 2.73 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.59 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|