About CID 87678093
CID 87678093 (PubChem CID 87678093) has the molecular formula C36H40AsN4O9S
and a molecular weight of 779.72 g/mol.
Molecular Properties
| Compound Name | CID 87678093 |
| PubChem CID | 87678093 |
| Molecular Formula | C36H40AsN4O9S |
| Molecular Weight | 779.72 g/mol |
| Exact Mass | 779.17 |
| IUPAC Name | — |
| SMILES | CCOc1cc(C([As]c2ccc3c(N)nccc3c2)C(=O)N2CCC(C(=O)O)C2c2cc([N+](=O)[O-])ccc2S(=O)(=O)C(C)C)ccc1OC(C)C |
| InChI | InChI=1S/C36H40AsN4O9S/c1-6-49-30-18-23(7-11-29(30)50-20(2)3)32(37-24-8-10-26-22(17-24)13-15-39-34(26)38)35(42)40-16-14-27(36(43)44)33(40)28-19-25(41(45)46)9-12-31(28)51(47,48)21(4)5/h7-13,15,17-21,27,32-33H,6,14,16H2,1-5H3,(H2,38,39)(H,43,44) |
| InChIKey | VNLHNLJSQDALCQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 192.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 779.72 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 87678093 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87678093?
The IUPAC name of CID 87678093 (CID 87678093) is not available.
What is the SMILES notation for CID 87678093?
The canonical SMILES for CID 87678093 is CCOc1cc(C([As]c2ccc3c(N)nccc3c2)C(=O)N2CCC(C(=O)O)C2c2cc([N+](=O)[O-])ccc2S(=O)(=O)C(C)C)ccc1OC(C)C.
What is the InChIKey of CID 87678093?
The InChIKey is VNLHNLJSQDALCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H40AsN4O9S/c1-6-49-30-18-23(7-11-29(30)50-20(2)3)32(37-24-8-10-26-22(17-24)13-15-39-34(26)38)35(42)40-16-14-27(36(43)44)33(40)28-19-25(41(45)46)9-12-31(28)51(47,48)21(4)5/h7-13,15,17-21,27,32-33H,6,14,16H2,1-5H3,(H2,38,39)(H,43,44).
What are the key properties of CID 87678093?
CID 87678093 has a molecular weight of 779.72 g/mol, XLogP of 4.84, 13 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87678093 is sourced from PubChem (CID 87678093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).