About 6-tert-butyl-2-methyl-8H-indeno[2,1-b]thiophene
6-tert-butyl-2-methyl-8H-indeno[2,1-b]thiophene (PubChem CID 87678267) has the molecular formula C16H18S
and a molecular weight of 242.39 g/mol. Its IUPAC name is 6-tert-butyl-2-methyl-8H-indeno[2,1-b]thiophene.
Molecular Properties
| Compound Name | 6-tert-butyl-2-methyl-8H-indeno[2,1-b]thiophene |
| PubChem CID | 87678267 |
| Molecular Formula | C16H18S |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 6-tert-butyl-2-methyl-8H-indeno[2,1-b]thiophene |
| SMILES | Cc1cc2c(s1)=CC1=CC(C(C)(C)C)=CCC=21 |
| InChI | InChI=1S/C16H18S/c1-10-7-14-13-6-5-12(16(2,3)4)8-11(13)9-15(14)17-10/h5,7-9H,6H2,1-4H3 |
| InChIKey | FMACDFCESYQSCY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-tert-butyl-2-methyl-8H-indeno[2,1-b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-2-methyl-8H-indeno[2,1-b]thiophene?
The IUPAC name of 6-tert-butyl-2-methyl-8H-indeno[2,1-b]thiophene (CID 87678267) is 6-tert-butyl-2-methyl-8H-indeno[2,1-b]thiophene.
What is the SMILES notation for 6-tert-butyl-2-methyl-8H-indeno[2,1-b]thiophene?
The canonical SMILES for 6-tert-butyl-2-methyl-8H-indeno[2,1-b]thiophene is Cc1cc2c(s1)=CC1=CC(C(C)(C)C)=CCC=21.
What is the InChIKey of 6-tert-butyl-2-methyl-8H-indeno[2,1-b]thiophene?
The InChIKey is FMACDFCESYQSCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18S/c1-10-7-14-13-6-5-12(16(2,3)4)8-11(13)9-15(14)17-10/h5,7-9H,6H2,1-4H3.
What are the key properties of 6-tert-butyl-2-methyl-8H-indeno[2,1-b]thiophene?
6-tert-butyl-2-methyl-8H-indeno[2,1-b]thiophene has a molecular weight of 242.39 g/mol, XLogP of 3.30, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-2-methyl-8H-indeno[2,1-b]thiophene is sourced from PubChem (CID 87678267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).