C20H26N4O3S — CID 87678567
1-[2-[2-[benzyl(methyl)amino]ethoxy]ethyl]-3-[(3-nitrophenyl)methyl]thiourea (PubChem CID 87678567) has the molecular formula C20H26N4O3S and a molecular weight of 402.52 g/mol. Its IUPAC name is 1-[2-[2-[benzyl(methyl)amino]ethoxy]ethyl]-3-[(3-nitrophenyl)methyl]thiourea.
| Compound Name | 1-[2-[2-[benzyl(methyl)amino]ethoxy]ethyl]-3-[(3-nitrophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 87678567 |
| Molecular Formula | C20H26N4O3S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 1-[2-[2-[benzyl(methyl)amino]ethoxy]ethyl]-3-[(3-nitrophenyl)methyl]thiourea |
| SMILES | CN(CCOCCNC(=S)NCc1cccc([N+](=O)[O-])c1)Cc1ccccc1 |
| InChI | InChI=1S/C20H26N4O3S/c1-23(16-17-6-3-2-4-7-17)11-13-27-12-10-21-20(28)22-15-18-8-5-9-19(14-18)24(25)26/h2-9,14H,10-13,15-16H2,1H3,(H2,21,22,28) |
| InChIKey | CQMGNZAAOTYJED-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 79.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|