About (4Z,6Z)-1,3-benzodiazocine
(4Z,6Z)-1,3-benzodiazocine (PubChem CID 87678856) has the molecular formula C10H8N2
and a molecular weight of 156.19 g/mol. Its IUPAC name is (4Z,6Z)-1,3-benzodiazocine.
Molecular Properties
| Compound Name | (4Z,6Z)-1,3-benzodiazocine |
| PubChem CID | 87678856 |
| Molecular Formula | C10H8N2 |
| Molecular Weight | 156.19 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | (4Z,6Z)-1,3-benzodiazocine |
| SMILES | C1=C\N=C/N=c2/cccc/c2=C/1 |
| InChI | InChI=1S/C10H8N2/c1-2-6-10-9(4-1)5-3-7-11-8-12-10/h1-8H/b5-3-,7-3-,9-5-,11-7-,11-8-,12-8-,12-10- |
| InChIKey | CYOAQWRCIHBRFE-TWVGMWEDSA-N |
| XLogP | 0.64 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.19 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4Z,6Z)-1,3-benzodiazocine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z,6Z)-1,3-benzodiazocine?
The IUPAC name of (4Z,6Z)-1,3-benzodiazocine (CID 87678856) is (4Z,6Z)-1,3-benzodiazocine.
What is the SMILES notation for (4Z,6Z)-1,3-benzodiazocine?
The canonical SMILES for (4Z,6Z)-1,3-benzodiazocine is C1=C\N=C/N=c2/cccc/c2=C/1.
What is the InChIKey of (4Z,6Z)-1,3-benzodiazocine?
The InChIKey is CYOAQWRCIHBRFE-TWVGMWEDSA-N. The full InChI is InChI=1S/C10H8N2/c1-2-6-10-9(4-1)5-3-7-11-8-12-10/h1-8H/b5-3-,7-3-,9-5-,11-7-,11-8-,12-8-,12-10-.
What are the key properties of (4Z,6Z)-1,3-benzodiazocine?
(4Z,6Z)-1,3-benzodiazocine has a molecular weight of 156.19 g/mol, XLogP of 0.64, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z,6Z)-1,3-benzodiazocine is sourced from PubChem (CID 87678856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).