About 1H-pyrrol-2-ylthiourea
1H-pyrrol-2-ylthiourea (PubChem CID 87679114) has the molecular formula C5H7N3S
and a molecular weight of 141.20 g/mol. Its IUPAC name is 1H-pyrrol-2-ylthiourea.
Molecular Properties
| Compound Name | 1H-pyrrol-2-ylthiourea |
| PubChem CID | 87679114 |
| Molecular Formula | C5H7N3S |
| Molecular Weight | 141.20 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | 1H-pyrrol-2-ylthiourea |
| SMILES | NC(=S)Nc1ccc[nH]1 |
| InChI | InChI=1S/C5H7N3S/c6-5(9)8-4-2-1-3-7-4/h1-3,7H,(H3,6,8,9) |
| InChIKey | YNHYIYKHHQEPGR-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.20 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyrrol-2-ylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrol-2-ylthiourea?
The IUPAC name of 1H-pyrrol-2-ylthiourea (CID 87679114) is 1H-pyrrol-2-ylthiourea.
What is the SMILES notation for 1H-pyrrol-2-ylthiourea?
The canonical SMILES for 1H-pyrrol-2-ylthiourea is NC(=S)Nc1ccc[nH]1.
What is the InChIKey of 1H-pyrrol-2-ylthiourea?
The InChIKey is YNHYIYKHHQEPGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N3S/c6-5(9)8-4-2-1-3-7-4/h1-3,7H,(H3,6,8,9).
What are the key properties of 1H-pyrrol-2-ylthiourea?
1H-pyrrol-2-ylthiourea has a molecular weight of 141.20 g/mol, XLogP of 0.67, 1 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrol-2-ylthiourea is sourced from PubChem (CID 87679114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).