C28H28N2O5S — CID 87679325
3-[5-(9H-fluoren-9-yloxycarbonylamino)-2,3,3-trimethylindol-1-ium-1-yl]propane-1-sulfonate (PubChem CID 87679325) has the molecular formula C28H28N2O5S and a molecular weight of 504.61 g/mol. Its IUPAC name is 3-[5-(9H-fluoren-9-yloxycarbonylamino)-2,3,3-trimethylindol-1-ium-1-yl]propane-1-sulfonate.
| Compound Name | 3-[5-(9H-fluoren-9-yloxycarbonylamino)-2,3,3-trimethylindol-1-ium-1-yl]propane-1-sulfonate |
|---|---|
| PubChem CID | 87679325 |
| Molecular Formula | C28H28N2O5S |
| Molecular Weight | 504.61 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | 3-[5-(9H-fluoren-9-yloxycarbonylamino)-2,3,3-trimethylindol-1-ium-1-yl]propane-1-sulfonate |
| SMILES | CC1=[N+](CCCS(=O)(=O)[O-])c2ccc(NC(=O)OC3c4ccccc4-c4ccccc43)cc2C1(C)C |
| InChI | InChI=1S/C28H28N2O5S/c1-18-28(2,3)24-17-19(13-14-25(24)30(18)15-8-16-36(32,33)34)29-27(31)35-26-22-11-6-4-9-20(22)21-10-5-7-12-23(21)26/h4-7,9-14,17,26H,8,15-16H2,1-3H3,(H-,29,31,32,33,34) |
| InChIKey | YZEGSENNDRUZLE-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.61 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|