C16H15N — CID 87680128
9-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,13,15-hexaene (PubChem CID 87680128) has the molecular formula C16H15N and a molecular weight of 221.30 g/mol. Its IUPAC name is 9-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,13,15-hexaene.
| Compound Name | 9-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,13,15-hexaene |
|---|---|
| PubChem CID | 87680128 |
| Molecular Formula | C16H15N |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 9-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,13,15-hexaene |
| SMILES | C1=CC2=c3ccccc3=CN3CCCC(=C1)C23 |
| InChI | InChI=1S/C16H15N/c1-2-8-14-13(5-1)11-17-10-4-7-12-6-3-9-15(14)16(12)17/h1-3,5-6,8-9,11,16H,4,7,10H2 |
| InChIKey | NCMHBWBCAFEYON-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |