C25H30F3N3O3 — CID 87680341
2,2,2-trifluoro-N-[1-[6-(3-piperidin-1-ylpropoxy)naphthalene-2-carbonyl]pyrrolidin-3-yl]acetamide (PubChem CID 87680341) has the molecular formula C25H30F3N3O3 and a molecular weight of 477.53 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[1-[6-(3-piperidin-1-ylpropoxy)naphthalene-2-carbonyl]pyrrolidin-3-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[1-[6-(3-piperidin-1-ylpropoxy)naphthalene-2-carbonyl]pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 87680341 |
| Molecular Formula | C25H30F3N3O3 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 2,2,2-trifluoro-N-[1-[6-(3-piperidin-1-ylpropoxy)naphthalene-2-carbonyl]pyrrolidin-3-yl]acetamide |
| SMILES | O=C(c1ccc2cc(OCCCN3CCCCC3)ccc2c1)N1CCC(NC(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C25H30F3N3O3/c26-25(27,28)24(33)29-21-9-13-31(17-21)23(32)20-6-5-19-16-22(8-7-18(19)15-20)34-14-4-12-30-10-2-1-3-11-30/h5-8,15-16,21H,1-4,9-14,17H2,(H,29,33) |
| InChIKey | GWQFDOZGQXCTDM-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|