C21H25NO2 — CID 87680930
N-methoxy-1-[(1S,2R,3S)-3-naphthalen-2-yl-8-oxabicyclo[3.2.1]octan-2-yl]propan-1-imine (PubChem CID 87680930) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is N-methoxy-1-[(1S,2R,3S)-3-naphthalen-2-yl-8-oxabicyclo[3.2.1]octan-2-yl]propan-1-imine.
| Compound Name | N-methoxy-1-[(1S,2R,3S)-3-naphthalen-2-yl-8-oxabicyclo[3.2.1]octan-2-yl]propan-1-imine |
|---|---|
| PubChem CID | 87680930 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | N-methoxy-1-[(1S,2R,3S)-3-naphthalen-2-yl-8-oxabicyclo[3.2.1]octan-2-yl]propan-1-imine |
| SMILES | CCC(=NOC)[C@@H]1[C@@H]2CCC(C[C@@H]1c1ccc3ccccc3c1)O2 |
| InChI | InChI=1S/C21H25NO2/c1-3-19(22-23-2)21-18(13-17-10-11-20(21)24-17)16-9-8-14-6-4-5-7-15(14)12-16/h4-9,12,17-18,20-21H,3,10-11,13H2,1-2H3/t17?,18-,20+,21-/m1/s1 |
| InChIKey | YWLFCJNKPWNJEE-VCCAVGLWSA-N |
| XLogP | 4.90 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|