About CID 87681448
CID 87681448 (PubChem CID 87681448) has the molecular formula C12H32GeN2Si4-2
and a molecular weight of 389.36 g/mol.
Molecular Properties
| Compound Name | CID 87681448 |
|---|
| PubChem CID | 87681448 |
|---|
| Molecular Formula | C12H32GeN2Si4-2 |
|---|
| Molecular Weight | 389.36 g/mol |
|---|
| Exact Mass | 390.09 |
|---|
| IUPAC Name | — |
|---|
| SMILES | C[Si]1(C)CC[Si](C)(C)[N-]1.C[Si]1(C)CC[Si](C)(C)[N-]1.[Ge] |
|---|
| InChI | InChI=1S/2C6H16NSi2.Ge/c2*1-8(2)5-6-9(3,4)7-8;/h2*5-6H2,1-4H3;/q2*-1; |
|---|
| InChIKey | PTUXGPQBGUUUJB-UHFFFAOYSA-N |
|---|
| XLogP | 5.19 |
|---|
| TPSA | 28.20 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 19 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
1 violation
| Rule | Value |
|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87681448 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87681448?
The IUPAC name of CID 87681448 (CID 87681448) is not available.
What is the SMILES notation for CID 87681448?
The canonical SMILES for CID 87681448 is C[Si]1(C)CC[Si](C)(C)[N-]1.C[Si]1(C)CC[Si](C)(C)[N-]1.[Ge].
What is the InChIKey of CID 87681448?
The InChIKey is PTUXGPQBGUUUJB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H16NSi2.Ge/c2*1-8(2)5-6-9(3,4)7-8;/h2*5-6H2,1-4H3;/q2*-1;.
What are the key properties of CID 87681448?
CID 87681448 has a molecular weight of 389.36 g/mol, XLogP of 5.19, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87681448 is sourced from PubChem (CID 87681448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).