About bicyclo[3.1.0]hexa-1(6),2,4-triene;1-ethynyl-3-prop-2-enoxybenzene
bicyclo[3.1.0]hexa-1(6),2,4-triene;1-ethynyl-3-prop-2-enoxybenzene (PubChem CID 87681709) has the molecular formula C17H14O
and a molecular weight of 234.30 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;1-ethynyl-3-prop-2-enoxybenzene.
Molecular Properties
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;1-ethynyl-3-prop-2-enoxybenzene |
| PubChem CID | 87681709 |
| Molecular Formula | C17H14O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;1-ethynyl-3-prop-2-enoxybenzene |
| SMILES | C#Cc1cccc(OCC=C)c1.c1cc2cc-2c1 |
| InChI | InChI=1S/C11H10O.C6H4/c1-3-8-12-11-7-5-6-10(4-2)9-11;1-2-5-4-6(5)3-1/h2-3,5-7,9H,1,8H2;1-4H |
| InChIKey | SXJRITVFXKANJH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[3.1.0]hexa-1(6),2,4-triene;1-ethynyl-3-prop-2-enoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[3.1.0]hexa-1(6),2,4-triene;1-ethynyl-3-prop-2-enoxybenzene?
The IUPAC name of bicyclo[3.1.0]hexa-1(6),2,4-triene;1-ethynyl-3-prop-2-enoxybenzene (CID 87681709) is bicyclo[3.1.0]hexa-1(6),2,4-triene;1-ethynyl-3-prop-2-enoxybenzene.
What is the SMILES notation for bicyclo[3.1.0]hexa-1(6),2,4-triene;1-ethynyl-3-prop-2-enoxybenzene?
The canonical SMILES for bicyclo[3.1.0]hexa-1(6),2,4-triene;1-ethynyl-3-prop-2-enoxybenzene is C#Cc1cccc(OCC=C)c1.c1cc2cc-2c1.
What is the InChIKey of bicyclo[3.1.0]hexa-1(6),2,4-triene;1-ethynyl-3-prop-2-enoxybenzene?
The InChIKey is SXJRITVFXKANJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O.C6H4/c1-3-8-12-11-7-5-6-10(4-2)9-11;1-2-5-4-6(5)3-1/h2-3,5-7,9H,1,8H2;1-4H.
What are the key properties of bicyclo[3.1.0]hexa-1(6),2,4-triene;1-ethynyl-3-prop-2-enoxybenzene?
bicyclo[3.1.0]hexa-1(6),2,4-triene;1-ethynyl-3-prop-2-enoxybenzene has a molecular weight of 234.30 g/mol, XLogP of 3.90, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.1.0]hexa-1(6),2,4-triene;1-ethynyl-3-prop-2-enoxybenzene is sourced from PubChem (CID 87681709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).