C17H14O — CID 87681709
bicyclo[3.1.0]hexa-1(6),2,4-triene;1-ethynyl-3-prop-2-enoxybenzene (PubChem CID 87681709) has the molecular formula C17H14O and a molecular weight of 234.30 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;1-ethynyl-3-prop-2-enoxybenzene.
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;1-ethynyl-3-prop-2-enoxybenzene |
|---|---|
| PubChem CID | 87681709 |
| Molecular Formula | C17H14O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;1-ethynyl-3-prop-2-enoxybenzene |
| SMILES | C#Cc1cccc(OCC=C)c1.c1cc2cc-2c1 |
| InChI | InChI=1S/C11H10O.C6H4/c1-3-8-12-11-7-5-6-10(4-2)9-11;1-2-5-4-6(5)3-1/h2-3,5-7,9H,1,8H2;1-4H |
| InChIKey | SXJRITVFXKANJH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|