About 2,2-dimethyl-3,4-dihydrochromene-6-sulfonic acid
2,2-dimethyl-3,4-dihydrochromene-6-sulfonic acid (PubChem CID 87681776) has the molecular formula C11H14O4S
and a molecular weight of 242.30 g/mol. Its IUPAC name is 2,2-dimethyl-3,4-dihydrochromene-6-sulfonic acid.
Molecular Properties
| Compound Name | 2,2-dimethyl-3,4-dihydrochromene-6-sulfonic acid |
| PubChem CID | 87681776 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 2,2-dimethyl-3,4-dihydrochromene-6-sulfonic acid |
| SMILES | CC1(C)CCc2cc(S(=O)(=O)O)ccc2O1 |
| InChI | InChI=1S/C11H14O4S/c1-11(2)6-5-8-7-9(16(12,13)14)3-4-10(8)15-11/h3-4,7H,5-6H2,1-2H3,(H,12,13,14) |
| InChIKey | UWIIBUBZDAFVMG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-3,4-dihydrochromene-6-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-3,4-dihydrochromene-6-sulfonic acid?
The IUPAC name of 2,2-dimethyl-3,4-dihydrochromene-6-sulfonic acid (CID 87681776) is 2,2-dimethyl-3,4-dihydrochromene-6-sulfonic acid.
What is the SMILES notation for 2,2-dimethyl-3,4-dihydrochromene-6-sulfonic acid?
The canonical SMILES for 2,2-dimethyl-3,4-dihydrochromene-6-sulfonic acid is CC1(C)CCc2cc(S(=O)(=O)O)ccc2O1.
What is the InChIKey of 2,2-dimethyl-3,4-dihydrochromene-6-sulfonic acid?
The InChIKey is UWIIBUBZDAFVMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O4S/c1-11(2)6-5-8-7-9(16(12,13)14)3-4-10(8)15-11/h3-4,7H,5-6H2,1-2H3,(H,12,13,14).
What are the key properties of 2,2-dimethyl-3,4-dihydrochromene-6-sulfonic acid?
2,2-dimethyl-3,4-dihydrochromene-6-sulfonic acid has a molecular weight of 242.30 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3,4-dihydrochromene-6-sulfonic acid is sourced from PubChem (CID 87681776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).