C18H24INO2 — CID 87682491
(3R,4S,5R)-4-(C-ethyl-N-methoxycarbonimidoyl)-3-(4-iodophenyl)bicyclo[3.2.1]octan-6-ol (PubChem CID 87682491) has the molecular formula C18H24INO2 and a molecular weight of 413.30 g/mol. Its IUPAC name is (3R,4S,5R)-4-(C-ethyl-N-methoxycarbonimidoyl)-3-(4-iodophenyl)bicyclo[3.2.1]octan-6-ol.
| Compound Name | (3R,4S,5R)-4-(C-ethyl-N-methoxycarbonimidoyl)-3-(4-iodophenyl)bicyclo[3.2.1]octan-6-ol |
|---|---|
| PubChem CID | 87682491 |
| Molecular Formula | C18H24INO2 |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | (3R,4S,5R)-4-(C-ethyl-N-methoxycarbonimidoyl)-3-(4-iodophenyl)bicyclo[3.2.1]octan-6-ol |
| SMILES | CCC(=NOC)[C@H]1[C@H](c2ccc(I)cc2)CC2CC(O)[C@@H]1C2 |
| InChI | InChI=1S/C18H24INO2/c1-3-16(20-22-2)18-14(12-4-6-13(19)7-5-12)8-11-9-15(18)17(21)10-11/h4-7,11,14-15,17-18,21H,3,8-10H2,1-2H3/t11?,14-,15-,17?,18-/m0/s1 |
| InChIKey | FOKNVOSQQLRQNZ-UUSPXZDNSA-N |
| XLogP | 4.19 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|