C17H23FN2O — CID 87682896
1-[(1R,2S,3S)-3-(4-fluorophenyl)-8-azabicyclo[3.2.1]octan-2-yl]-N-methoxypropan-1-imine (PubChem CID 87682896) has the molecular formula C17H23FN2O and a molecular weight of 290.38 g/mol. Its IUPAC name is 1-[(1R,2S,3S)-3-(4-fluorophenyl)-8-azabicyclo[3.2.1]octan-2-yl]-N-methoxypropan-1-imine.
| Compound Name | 1-[(1R,2S,3S)-3-(4-fluorophenyl)-8-azabicyclo[3.2.1]octan-2-yl]-N-methoxypropan-1-imine |
|---|---|
| PubChem CID | 87682896 |
| Molecular Formula | C17H23FN2O |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 1-[(1R,2S,3S)-3-(4-fluorophenyl)-8-azabicyclo[3.2.1]octan-2-yl]-N-methoxypropan-1-imine |
| SMILES | CCC(=NOC)[C@H]1[C@@H](c2ccc(F)cc2)CC2CC[C@H]1N2 |
| InChI | InChI=1S/C17H23FN2O/c1-3-15(20-21-2)17-14(10-13-8-9-16(17)19-13)11-4-6-12(18)7-5-11/h4-7,13-14,16-17,19H,3,8-10H2,1-2H3/t13?,14-,16-,17-/m1/s1 |
| InChIKey | SIABIHIZPZSDEV-REIUFEAVSA-N |
| XLogP | 3.46 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|