About (4S)-4-methyl-1,3-diazinane-2-thione
(4S)-4-methyl-1,3-diazinane-2-thione (PubChem CID 87683022) has the molecular formula C5H10N2S
and a molecular weight of 130.22 g/mol. Its IUPAC name is (4S)-4-methyl-1,3-diazinane-2-thione.
Molecular Properties
| Compound Name | (4S)-4-methyl-1,3-diazinane-2-thione |
| PubChem CID | 87683022 |
| Molecular Formula | C5H10N2S |
| Molecular Weight | 130.22 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | (4S)-4-methyl-1,3-diazinane-2-thione |
| SMILES | C[C@H]1CCNC(=S)N1 |
| InChI | InChI=1S/C5H10N2S/c1-4-2-3-6-5(8)7-4/h4H,2-3H2,1H3,(H2,6,7,8)/t4-/m0/s1 |
| InChIKey | XNNIDXFRCYZKDF-BYPYZUCNSA-N |
| XLogP | 0.24 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.22 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-methyl-1,3-diazinane-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-methyl-1,3-diazinane-2-thione?
The IUPAC name of (4S)-4-methyl-1,3-diazinane-2-thione (CID 87683022) is (4S)-4-methyl-1,3-diazinane-2-thione.
What is the SMILES notation for (4S)-4-methyl-1,3-diazinane-2-thione?
The canonical SMILES for (4S)-4-methyl-1,3-diazinane-2-thione is C[C@H]1CCNC(=S)N1.
What is the InChIKey of (4S)-4-methyl-1,3-diazinane-2-thione?
The InChIKey is XNNIDXFRCYZKDF-BYPYZUCNSA-N. The full InChI is InChI=1S/C5H10N2S/c1-4-2-3-6-5(8)7-4/h4H,2-3H2,1H3,(H2,6,7,8)/t4-/m0/s1.
What are the key properties of (4S)-4-methyl-1,3-diazinane-2-thione?
(4S)-4-methyl-1,3-diazinane-2-thione has a molecular weight of 130.22 g/mol, XLogP of 0.24, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-methyl-1,3-diazinane-2-thione is sourced from PubChem (CID 87683022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).