C22H28N2O — CID 87683274
N-methoxy-1-[(1R,2S,3R)-8-methyl-3-naphthalen-2-yl-8-azabicyclo[3.2.1]octan-2-yl]propan-1-imine (PubChem CID 87683274) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is N-methoxy-1-[(1R,2S,3R)-8-methyl-3-naphthalen-2-yl-8-azabicyclo[3.2.1]octan-2-yl]propan-1-imine.
| Compound Name | N-methoxy-1-[(1R,2S,3R)-8-methyl-3-naphthalen-2-yl-8-azabicyclo[3.2.1]octan-2-yl]propan-1-imine |
|---|---|
| PubChem CID | 87683274 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | N-methoxy-1-[(1R,2S,3R)-8-methyl-3-naphthalen-2-yl-8-azabicyclo[3.2.1]octan-2-yl]propan-1-imine |
| SMILES | CCC(=NOC)[C@@H]1[C@H]2CCC(C[C@H]1c1ccc3ccccc3c1)N2C |
| InChI | InChI=1S/C22H28N2O/c1-4-20(23-25-3)22-19(14-18-11-12-21(22)24(18)2)17-10-9-15-7-5-6-8-16(15)13-17/h5-10,13,18-19,21-22H,4,11-12,14H2,1-3H3/t18?,19-,21+,22+/m0/s1 |
| InChIKey | XSTFQBXVMVUFAT-SPPJFZGQSA-N |
| XLogP | 4.82 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|