C22H28F8O6Si2 — CID 87683704
triethoxy-[4-(trifluoromethyl)phenyl]silane;trimethoxy-(2,3,4,5,6-pentafluorophenyl)silane (PubChem CID 87683704) has the molecular formula C22H28F8O6Si2 and a molecular weight of 596.62 g/mol. Its IUPAC name is triethoxy-[4-(trifluoromethyl)phenyl]silane;trimethoxy-(2,3,4,5,6-pentafluorophenyl)silane.
| Compound Name | triethoxy-[4-(trifluoromethyl)phenyl]silane;trimethoxy-(2,3,4,5,6-pentafluorophenyl)silane |
|---|---|
| PubChem CID | 87683704 |
| Molecular Formula | C22H28F8O6Si2 |
| Molecular Weight | 596.62 g/mol |
| Exact Mass | 596.13 |
| IUPAC Name | triethoxy-[4-(trifluoromethyl)phenyl]silane;trimethoxy-(2,3,4,5,6-pentafluorophenyl)silane |
| SMILES | CCO[Si](OCC)(OCC)c1ccc(C(F)(F)F)cc1.CO[Si](OC)(OC)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H19F3O3Si.C9H9F5O3Si/c1-4-17-20(18-5-2,19-6-3)12-9-7-11(8-10-12)13(14,15)16;1-15-18(16-2,17-3)9-7(13)5(11)4(10)6(12)8(9)14/h7-10H,4-6H2,1-3H3;1-3H3 |
| InChIKey | TWYZXNNQADTTHD-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.62 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|