C17H22FNO2S — CID 87683971
(3S,4R,5S)-4-(C-ethyl-N-methoxycarbonimidoyl)-3-(4-fluorophenyl)-8-thiabicyclo[3.2.1]octan-6-ol (PubChem CID 87683971) has the molecular formula C17H22FNO2S and a molecular weight of 323.43 g/mol. Its IUPAC name is (3S,4R,5S)-4-(C-ethyl-N-methoxycarbonimidoyl)-3-(4-fluorophenyl)-8-thiabicyclo[3.2.1]octan-6-ol.
| Compound Name | (3S,4R,5S)-4-(C-ethyl-N-methoxycarbonimidoyl)-3-(4-fluorophenyl)-8-thiabicyclo[3.2.1]octan-6-ol |
|---|---|
| PubChem CID | 87683971 |
| Molecular Formula | C17H22FNO2S |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | (3S,4R,5S)-4-(C-ethyl-N-methoxycarbonimidoyl)-3-(4-fluorophenyl)-8-thiabicyclo[3.2.1]octan-6-ol |
| SMILES | CCC(=NOC)[C@H]1[C@@H](c2ccc(F)cc2)CC2CC(O)[C@H]1S2 |
| InChI | InChI=1S/C17H22FNO2S/c1-3-14(19-21-2)16-13(10-4-6-11(18)7-5-10)8-12-9-15(20)17(16)22-12/h4-7,12-13,15-17,20H,3,8-9H2,1-2H3/t12?,13-,15?,16-,17-/m1/s1 |
| InChIKey | IAWQFKTXJCYWHM-PMJSHVRXSA-N |
| XLogP | 3.58 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|