C14H23N5O2S3 — CID 8768556
1-[(4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbonyl)amino]-3-(3-methylsulfanylpropyl)thiourea (PubChem CID 8768556) has the molecular formula C14H23N5O2S3 and a molecular weight of 389.57 g/mol. Its IUPAC name is 1-[(4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbonyl)amino]-3-(3-methylsulfanylpropyl)thiourea.
| Compound Name | 1-[(4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbonyl)amino]-3-(3-methylsulfanylpropyl)thiourea |
|---|---|
| PubChem CID | 8768556 |
| Molecular Formula | C14H23N5O2S3 |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 1-[(4-methyl-2-morpholin-4-yl-1,3-thiazole-5-carbonyl)amino]-3-(3-methylsulfanylpropyl)thiourea |
| SMILES | CSCCCNC(=S)NNC(=O)c1sc(N2CCOCC2)nc1C |
| InChI | InChI=1S/C14H23N5O2S3/c1-10-11(24-14(16-10)19-5-7-21-8-6-19)12(20)17-18-13(22)15-4-3-9-23-2/h3-9H2,1-2H3,(H,17,20)(H2,15,18,22) |
| InChIKey | JDTOYUWBBXCAQJ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|