C22H18O7 — CID 87686038
(2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-pyren-2-yloxyoxane-2-carboxylic acid (PubChem CID 87686038) has the molecular formula C22H18O7 and a molecular weight of 394.38 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-pyren-2-yloxyoxane-2-carboxylic acid.
| Compound Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-pyren-2-yloxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 87686038 |
| Molecular Formula | C22H18O7 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-pyren-2-yloxyoxane-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1O[C@@H](Oc2cc3ccc4cccc5ccc(c2)c3c45)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H18O7/c23-17-18(24)20(21(26)27)29-22(19(17)25)28-14-8-12-6-4-10-2-1-3-11-5-7-13(9-14)16(12)15(10)11/h1-9,17-20,22-25H,(H,26,27)/t17-,18-,19+,20-,22+/m0/s1 |
| InChIKey | PLSFGBXKRWEHFF-SXFAUFNYSA-N |
| XLogP | 1.86 |
| TPSA | 116.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|