About (E)-1-(3,4-dichlorocyclohexa-1,5-dien-1-yl)-3-methylbut-1-ene-2-thiol
(E)-1-(3,4-dichlorocyclohexa-1,5-dien-1-yl)-3-methylbut-1-ene-2-thiol (PubChem CID 87686145) has the molecular formula C11H14Cl2S
and a molecular weight of 249.21 g/mol. Its IUPAC name is (E)-1-(3,4-dichlorocyclohexa-1,5-dien-1-yl)-3-methylbut-1-ene-2-thiol.
Molecular Properties
| Compound Name | (E)-1-(3,4-dichlorocyclohexa-1,5-dien-1-yl)-3-methylbut-1-ene-2-thiol |
| PubChem CID | 87686145 |
| Molecular Formula | C11H14Cl2S |
| Molecular Weight | 249.21 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | (E)-1-(3,4-dichlorocyclohexa-1,5-dien-1-yl)-3-methylbut-1-ene-2-thiol |
| SMILES | CC(C)/C(S)=C\C1=CC(Cl)C(Cl)C=C1 |
| InChI | InChI=1S/C11H14Cl2S/c1-7(2)11(14)6-8-3-4-9(12)10(13)5-8/h3-7,9-10,14H,1-2H3/b11-6+ |
| InChIKey | HSUUIINWUPQUOM-IZZDOVSWSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.21 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-(3,4-dichlorocyclohexa-1,5-dien-1-yl)-3-methylbut-1-ene-2-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-(3,4-dichlorocyclohexa-1,5-dien-1-yl)-3-methylbut-1-ene-2-thiol?
The IUPAC name of (E)-1-(3,4-dichlorocyclohexa-1,5-dien-1-yl)-3-methylbut-1-ene-2-thiol (CID 87686145) is (E)-1-(3,4-dichlorocyclohexa-1,5-dien-1-yl)-3-methylbut-1-ene-2-thiol.
What is the SMILES notation for (E)-1-(3,4-dichlorocyclohexa-1,5-dien-1-yl)-3-methylbut-1-ene-2-thiol?
The canonical SMILES for (E)-1-(3,4-dichlorocyclohexa-1,5-dien-1-yl)-3-methylbut-1-ene-2-thiol is CC(C)/C(S)=C\C1=CC(Cl)C(Cl)C=C1.
What is the InChIKey of (E)-1-(3,4-dichlorocyclohexa-1,5-dien-1-yl)-3-methylbut-1-ene-2-thiol?
The InChIKey is HSUUIINWUPQUOM-IZZDOVSWSA-N. The full InChI is InChI=1S/C11H14Cl2S/c1-7(2)11(14)6-8-3-4-9(12)10(13)5-8/h3-7,9-10,14H,1-2H3/b11-6+.
What are the key properties of (E)-1-(3,4-dichlorocyclohexa-1,5-dien-1-yl)-3-methylbut-1-ene-2-thiol?
(E)-1-(3,4-dichlorocyclohexa-1,5-dien-1-yl)-3-methylbut-1-ene-2-thiol has a molecular weight of 249.21 g/mol, XLogP of 4.17, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-(3,4-dichlorocyclohexa-1,5-dien-1-yl)-3-methylbut-1-ene-2-thiol is sourced from PubChem (CID 87686145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).